You can:
Name | CHEMBL39603 |
---|---|
Molecular formula | C21H25NO2 |
IUPAC name | 1-[4-[[4-(piperidin-1-ylmethyl)phenyl]methoxy]phenyl]ethanone |
Molecular weight | 323.436 |
Hydrogen bond acceptor | 3 |
Hydrogen bond donor | 0 |
XlogP | 3.8 |
Synonyms | SCHEMBL12128667 alpha-(4-Acetylphenoxy)-alpha'-piperidino p-xylol CHEMBL1178750 1-[4-(4-Piperidin-1-ylmethyl-benzyloxy)-phenyl]-ethanone; compound with oxalic acid ARBBIPRORVNXCC-UHFFFAOYSA-N [ Show all ] |
Inchi Key | ARBBIPRORVNXCC-UHFFFAOYSA-N |
Inchi ID | InChI=1S/C21H25NO2/c1-17(23)20-9-11-21(12-10-20)24-16-19-7-5-18(6-8-19)15-22-13-3-2-4-14-22/h5-12H,2-4,13-16H2,1H3 |
PubChem CID | 10936212 |
ChEMBL | N/A |
IUPHAR | N/A |
BindingDB | 50126884 |
DrugBank | N/A |
Structure | ![]() |
Lipinski's druglikeness | This ligand satisfies Lipinski's rule of five. |
You can:
GLASS ID | Name | UniProt | Gene | Species | Length |
---|---|---|---|---|---|
12270 | Histamine H1 receptor | P31389 | HRH1 | Cavia porcellus (Guinea pig) | 488 |
12272 | Histamine H2 receptor | P47747 | HRH2 | Cavia porcellus (Guinea pig) | 359 |
12271 | Histamine H3 receptor | Q9JI35 | HRH3 | Cavia porcellus (Guinea pig) | 445 |
12273 | Histamine H3 receptor | Q9Y5N1 | HRH3 | Homo sapiens (Human) | 445 |
yangzhanglabzhanggroup.org | (734) 647-1549 | 100 Washtenaw Avenue, Ann Arbor, MI 48109-2218