You can:
Name | KF-17837 |
---|---|
Molecular formula | C22H28N4O4 |
IUPAC name | 8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-7-methyl-1,3-dipropylpurine-2,6-dione |
Molecular weight | 412.49 |
Hydrogen bond acceptor | 5 |
Hydrogen bond donor | 0 |
XlogP | 3.6 |
Synonyms | 8-[2-(3,4-Dimethoxy-phenyl)-vinyl]-7-methyl-1,3-dipropyl-3,7-dihydro-purine-2,6-dione; compound with 8-[2-(3,4-dimethoxy-phenyl)-vinyl]-7-methyl-1,3-dipropyl-3,7-dihydro-purine-2,6-dione L006852 1H-Purine-2,6-dione, 3,7-dihydro-8-(2-(3,4-dimethoxyphenyl)ethenyl)-1,3-dipropyl-7-methyl-, (E)- SCHEMBL537086 8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-7-methyl-1,3-dipropylpurine-2,6-dione [ Show all ] |
Inchi Key | UQGGPCQNHJCOPS-PKNBQFBNSA-N |
Inchi ID | InChI=1S/C22H28N4O4/c1-6-12-25-20-19(21(27)26(13-7-2)22(25)28)24(3)18(23-20)11-9-15-8-10-16(29-4)17(14-15)30-5/h8-11,14H,6-7,12-13H2,1-5H3/b11-9+ |
PubChem CID | 6448585 |
ChEMBL | CHEMBL27508 |
IUPHAR | N/A |
BindingDB | 50006710 |
DrugBank | N/A |
Structure | |
Lipinski's druglikeness | This ligand satisfies Lipinski's rule of five. |
You can:
GLASS ID | Name | UniProt | Gene | Species | Length |
---|---|---|---|---|---|
342852 | Adenosine receptor A1 | P25099 | Adora1 | Rattus norvegicus (Rat) | 326 |
342858 | Adenosine receptor A1 | P47745 | ADORA1 | Cavia porcellus (Guinea pig) | 326 |
342859 | Adenosine receptor A1 | P30542 | ADORA1 | Homo sapiens (Human) | 326 |
342853 | Adenosine receptor A2a | P29274 | ADORA2A | Homo sapiens (Human) | 412 |
342854 | Adenosine receptor A2a | P30543 | Adora2a | Rattus norvegicus (Rat) | 410 |
342855 | Adenosine receptor A2b | P29275 | ADORA2B | Homo sapiens (Human) | 332 |
342857 | Adenosine receptor A2b | P29276 | Adora2b | Rattus norvegicus (Rat) | 332 |
342856 | Adenosine receptor A3 | P0DMS8 | ADORA3 | Homo sapiens (Human) | 318 |
zhanglabzhanggroup.org | (734) 647-1549 | 100 Washtenaw Avenue, Ann Arbor, MI 48109-2218