You can:
Name | 2-Phenylcyclopropanamine |
---|---|
Molecular formula | C9H11N |
IUPAC name | 2-phenylcyclopropan-1-amine |
Molecular weight | 133.194 |
Hydrogen bond acceptor | 1 |
Hydrogen bond donor | 1 |
XlogP | 1.5 |
Synonyms | Tranylcypromine [INN:BAN] CTK1F7780 D0H0HJ GlaxoSmithKline Brand of Tranylcypromine Sulfate KBio2_007214 [ Show all ] |
Inchi Key | AELCINSCMGFISI-UHFFFAOYSA-N |
Inchi ID | InChI=1S/C9H11N/c10-9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6,10H2 |
PubChem CID | 5530 |
ChEMBL | CHEMBL313833 |
IUPHAR | N/A |
BindingDB | 50113851 |
DrugBank | N/A |
Structure | |
Lipinski's druglikeness | This ligand satisfies Lipinski's rule of five. |
You can:
GLASS ID | Name | UniProt | Gene | Species | Length |
---|---|---|---|---|---|
3600 | 5-hydroxytryptamine receptor 1A | P08908 | HTR1A | Homo sapiens (Human) | 422 |
3596 | 5-hydroxytryptamine receptor 2A | P28223 | HTR2A | Homo sapiens (Human) | 471 |
555495 | 5-hydroxytryptamine receptor 2A | P14842 | Htr2a | Rattus norvegicus (Rat) | 471 |
3594 | 5-hydroxytryptamine receptor 2B | P41595 | HTR2B | Homo sapiens (Human) | 481 |
3595 | 5-hydroxytryptamine receptor 2C | P28335 | HTR2C | Homo sapiens (Human) | 458 |
3599 | 5-hydroxytryptamine receptor 2C | P08909 | Htr2c | Rattus norvegicus (Rat) | 460 |
3597 | D(1A) dopamine receptor | P21728 | DRD1 | Homo sapiens (Human) | 446 |
3598 | D(2) dopamine receptor | P14416 | DRD2 | Homo sapiens (Human) | 443 |
zhanglabzhanggroup.org | (734) 647-1549 | 100 Washtenaw Avenue, Ann Arbor, MI 48109-2218